SER-601
From LTRC
| তথ্যছক | |
|---|---|
| verifiedfields | changed |
| verifiedrevid | 477856349 |
| iupac_name | N-(Adamant-1-yl)-1-pentyl-4-oxo-6-isopropyl-1,4-dihydroquinoline-3-carboxamide |
| width | 200 |
| routes_of_administration | মৌখিক (Oral) |
| excretion | |
| cas_number_ref | CAS |
| cas_number | 1048038-90-9 |
| unii_ref | FDA |
| unii | S723GJY405 |
| chembl_ref | EBI |
| chembl | 502276 |
| pubchem | 25034551 |
| chemspiderid_ref | chemspider |
| chemspiderid | 24606023 |
| c | 28 |
| h | 38 |
| n | 2 |
| o | 2 |
| smiles | CC(C)c5ccc(c1c5)n(CCCCC)cc(c1=O)C(=O)NC4(C2)CC(CC2C3)CC3C4 |
| stdinchi_ref | chemspider |
| stdinchi | 1S/C28H38N2O2/c1-4-5-6-9-30-17-24(26(31)23-13-22(18(2)3)7-8-25(23)30)27(32)29-28-14-19-10-20(15-28)12-21(11-19)16-28/h7-8,13,17-21H,4-6,9-12,14-16H2,1-3H3,(H,29,32) |
| stdinchikey_ref | chemspider |
| stdinchikey | KUMKLUDNETVLDS-UHFFFAOYSA-N |
SER-601 (COR-167) হলো একটি ওষুধ যা একটি শক্তিশালী এবং নির্বাচনী ক্যানাবিনয়েড CB2 রিসেপ্টর অ্যাগোনিস্ট হিসেবে কাজ করে। এটি কুইনোলন-৩-কার্বক্সিলিক অ্যাসিড কোর কাঠামোর ওপর ভিত্তি করে তৈরি এবং এটি সংশ্লিষ্ট CB1 রিসেপ্টর-এর তুলনায় CB2-এর প্রতি ১৯০ গুণ বেশি নির্বাচনী। প্রাণীদের ওপর করা গবেষণায় দেখা গেছে যে, এর ব্যথানাশক প্রভাব রয়েছে, পাশাপাশি এটি নিউরন সুরক্ষাকারী (neuroprotective) হিসেবেও কাজ করে।[1] তবে CB1-এর প্রতি এর আসক্তি কম হওয়ায় এটি সেবনে কোনো "ক্যানাবিস হাই" বা নেশা হয় না।[2] এই ধরনের আরও বেশ কিছু যৌগ পরিচিত, যার প্রায় সবগুলোই CB2-এর প্রতি উচ্চ নির্বাচনী ক্ষমতা প্রদর্শন করে।[3]
আরও দেখুন
তথ্যসূত্র
- ↑ (December 2012). "A novel CB2 agonist, COR167, potently protects rat brain cortical slices against OGD and reperfusion injury". Pharmacological Research. 66 (6) 555–563. doi:10.1016/j.phrs.2012.08.003.
- ↑ (August 2008). "Investigations on the 4-quinolone-3-carboxylic acid motif. 2. Synthesis and structure-activity relationship of potent and selective cannabinoid-2 receptor agonists endowed with analgesic activity in vivo". Journal of Medicinal Chemistry. 51 (16) 5075–5084. doi:10.1021/jm800552f.
- ↑ (August 2010). "Investigations on the 4-quinolone-3-carboxylic acid motif. 3. Synthesis, structure-affinity relationships, and pharmacological characterization of 6-substituted 4-quinolone-3-carboxamides as highly selective cannabinoid-2 receptor ligands". Journal of Medicinal Chemistry. 53 (16) 5915–5928. doi:10.1021/jm100123x.
উৎস: ইংরেজি উইকিপিডিয়ার “SER-601” নিবন্ধের অনুবাদ। মূল নিবন্ধ: https://en.wikipedia.org/wiki/SER-601 এই অনুবাদটি স্বয়ংক্রিয়ভাবে প্রস্তুত করা হয়েছে।
