L-759,656
| তথ্যছক | |
|---|---|
| verifiedfields | changed |
| watchedfields | changed |
| verifiedrevid | 424761085 |
| iupac_name | (6aR,10aR)-1-methoxy-6,6-dimethyl-9-methylidene-3-(2-methyloctan-2-yl)-7,8,10,10a-tetrahydro-6aH-benzo[c]chromene |
| width | 240 |
| routes_of_administration | |
| excretion | |
| cas_number_ref | ?? |
| cas_number | 174627-56-6 |
| pubchem | 5311216 |
| iuphar_ligand | 749 |
| chembl_ref | EBI |
| chembl | 294013 |
| chemspiderid_ref | chemspider |
| chemspiderid | 4470735 |
| c | 26 |
| h | 40 |
| o | 2 |
| smiles | CCCCCCC(C)(C)c1cc2c(c(c1)OC)[C@@H]3CC(=C)CC[C@H]3C(O2)(C)C |
| stdinchi_ref | chemspider |
| stdinchi | 1S/C26H40O2/c1-8-9-10-11-14-25(3,4)19-16-22(27-7)24-20-15-18(2)12-13-21(20)26(5,6)28-23(24)17-19/h16-17,20-21H,2,8-15H2,1,3-7H3/t20-,21-/m1/s1 |
| stdinchikey_ref | chemspider |
| stdinchikey | BJIIKHXAZBTGLF-NHCUHLMSSA-N |
L-759,656 হলো একটি ব্যথানাশক ওষুধ যা একটি ক্যানাবিনয়েড অ্যাগোনিস্ট হিসেবে কাজ করে। এটি CB2 রিসেপ্টর-এর জন্য অত্যন্ত নির্বাচনী (highly selective) একটি অ্যাগোনিস্ট। এটি CB1-এর তুলনায় CB2-এর ক্ষেত্রে ৪১৪ গুণ বেশি নির্বাচনী,[1] যদিও এটি HU-308-এর মতো নতুন এজেন্টগুলোর মতো এতটা নির্বাচনী নয়।
এটি অন্যান্য ক্যানাবিনয়েড অ্যাগোনিস্টের মতো কিছু প্রভাব তৈরি করে, যেমন—ব্যথানাশক প্রভাব। তবে এর CB1 রিসেপ্টরের ওপর কার্যকারিতা দুর্বল হওয়ায় এটি খুব সামান্য বা কোনো নিদ্রাকারক বা মনস্তাত্ত্বিক প্রভাব ফেলে না। অন্যদিকে, CB2 রিসেপ্টরের ওপর শক্তিশালী কার্যকারিতার কারণে এটি বেশ কার্যকর প্রদাহবিরোধী প্রভাব প্রদর্শন করে।[2][3]
আরও দেখুন
তথ্যসূত্র
- ↑ (February 1999). "Agonist-inverse agonist characterization at CB1 and CB2 cannabinoid receptors of L759633, L759656, and AM630". British Journal of Pharmacology. 126 (3) 665–72. doi:10.1038/sj.bjp.0702351.
- ↑ (September 2000). "The search for selective ligands for the CB2 receptor". Current Pharmaceutical Design. 6 (13) 1323–37. doi:10.2174/1381612003399347.
- ↑ (July 2005). "CB2 receptor ligands". Mini Reviews in Medicinal Chemistry. 5 (7) 641–9. doi:10.2174/1389557054368844.
উৎস: ইংরেজি উইকিপিডিয়ার “L-759,656” নিবন্ধের অনুবাদ। মূল নিবন্ধ: https://en.wikipedia.org/wiki/L-759,656 এই অনুবাদটি স্বয়ংক্রিয়ভাবে প্রস্তুত করা হয়েছে।
