ক্যানবিসল
From LTRC
| তথ্যছক | |
|---|---|
| verifiedfields | changed |
| watchedfields | changed |
| class | ক্যানাবিনয়েড |
| verifiedrevid | 451563858 |
| iupac_name | (6aR,9R,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromene-1,9-diol |
| width | 250 |
| width2 | 250 |
| routes_of_administration | |
| excretion | |
| cas_number_ref | ?? |
| cas_number | 56689-43-1 |
| atc_prefix | none |
| pubchem | 41969 |
| chembl_ref | EBI |
| chembl | 2105525 |
| drugbank_ref | drugbank |
| unii_ref | FDA |
| unii | NZ1ZPC4WSF |
| chemspiderid_ref | chemspider |
| chemspiderid | 16736847 |
| c | 24 |
| h | 38 |
| o | 3 |
| smiles | Oc1cc(C(C)(C)CCCCCC)cc(c1C2C3)OC(C)(C)C2CCC3O |
| stdinchi_ref | chemspider |
| stdinchi | 1S/C24H38O3/c1-6-7-8-9-12-23(2,3)16-13-20(26)22-18-15-17(25)10-11-19(18)24(4,5)27-21(22)14-16/h13-14,17-19,25-26H,6-12,15H2,1-5H3/t17?,18-,19-/m0/s1 |
| stdinchikey_ref | chemspider |
| stdinchikey | UEKGZFCGRQYMRM-MNNMKWMVSA-N |
ক্যানবিসল (ন্যাবিড্রক্স) হলো একটি সংশ্লেষিত ক্যানাবিনয়েড ডেরিভেটিভ, যা ৯-নর-৯β-হাইড্রক্সিহেক্সাহাইড্রোক্যানাবিনল (HHC)-এর ডাইমিথাইলহেপটিল সমগোত্রীয় (homologue)। এটি CB1 এবং CB2 উভয় রিসেপ্টর-এর একটি শক্তিশালী অ্যাগোনিস্ট। এর বাইন্ডিং অ্যাফিনিটি বা আবদ্ধ হওয়ার ক্ষমতা CB1-এর ক্ষেত্রে ০.১ nM এবং CB2-এর ক্ষেত্রে ০.২ nM।[1] এটি মূলত বৈজ্ঞানিক গবেষণায় ব্যবহৃত হয়, বিশেষ করে ক্যানাবিনয়েড রিসেপ্টরগুলোর গঠন ও কার্যকারিতা নির্ধারণের জন্য রিসেপ্টর বাইন্ডিং গবেষণায়।[2][3][4] তবে ক্যানাবিনোমিমেটিক ড্রাগ হিসেবে অপব্যবহারের সম্ভাবনার কারণে কিছু দেশে এটিকে অবৈধ ঘোষণা করা হয়েছে।[5]
আরও দেখুন
তথ্যসূত্র
- ↑ (September 1997). "Cannabinol derivatives: binding to cannabinoid receptors and inhibition of adenylylcyclase". Journal of Medicinal Chemistry. 40 (20) 3228–33. doi:10.1021/jm970126f.
- ↑ (December 2000). "Functional role of tryptophan residues in the fourth transmembrane domain of the CB(2) cannabinoid receptor". Journal of Neurochemistry. 75 (6) 2485–91. doi:10.1046/j.1471-4159.2000.0752485.x.
- ↑ (September 2002). "Functional role of serine residues of transmembrane dopamin VII in signal transduction of CB2 cannabinoid receptor". Journal of Veterinary Science. 3 (3) 185–91. doi:10.4142/jvs.2002.3.3.185.
- ↑ (July 2005). "Cysteine 2.59(89) in the second transmembrane domain of human CB2 receptor is accessible within the ligand binding crevice: evidence for possible CB2 deviation from a rhodopsin template". Molecular Pharmacology. 68 (1) 69–83. doi:10.1124/mol.104.007823.
- ↑ The Misuse of Drugs Act 1971 (Amendment) Order 2009
উৎস: ইংরেজি উইকিপিডিয়ার “Canbisol” নিবন্ধের অনুবাদ। মূল নিবন্ধ: https://en.wikipedia.org/wiki/Canbisol এই অনুবাদটি স্বয়ংক্রিয়ভাবে প্রস্তুত করা হয়েছে।
