Org 28611
From LTRC
| তথ্যছক | |
|---|---|
| verifiedfields | changed |
| verifiedrevid | 459852163 |
| iupac_name | [1-(cyclohexylmethyl)-7-methoxyindol-3-yl]-[(3S)-3,4-dimethylpiperazin-1-yl]methanone |
| width | 200 |
| legal_ca | Schedule II |
| legal_de | NpSG |
| legal_uk | PSA |
| routes_of_administration | |
| excretion | |
| cas_number_ref | ?? |
| cas_number | 639068-99-8 |
| unii_ref | FDA |
| unii | 1U7V49NTQG |
| chembl_ref | EBI |
| chembl | 1209709 |
| pubchem | 10091392 |
| chemspiderid_ref | chemspider |
| chemspiderid | 8266929 |
| c | 23 |
| h | 33 |
| n | 3 |
| o | 2 |
| smiles | COc3cccc(c13)c(C(=O)N(CC2C)CCN2C)cn1CC4CCCCC4 |
| stdinchi_ref | chemspider |
| stdinchi | 1S/C23H33N3O2/c1-17-14-25(13-12-24(17)2)23(27)20-16-26(15-18-8-5-4-6-9-18)22-19(20)10-7-11-21(22)28-3/h7,10-11,16-18H,4-6,8-9,12-15H2,1-3H3/t17-/m0/s1 |
| stdinchikey_ref | chemspider |
| stdinchikey | ONXJNAIZJKLJGA-KRWDZBQOSA-N |
Org 28611 (SCH-900,111) হলো Organon International কর্তৃক উদ্ভাবিত একটি ওষুধ, যা ক্যানাবিনয়েড রিসেপ্টর ফুল অ্যাগোনিস্ট হিসেবে CB1 এবং CB2 উভয় রিসেপ্টরেই শক্তিশালী ভূমিকা পালন করে। এটি ব্যথানাশক হিসেবে শিরাপথে ব্যবহারের উপযোগী একটি পানিতে দ্রবণীয় ক্যানাবিনয়েড অ্যাগোনিস্ট তৈরির লক্ষ্যে উদ্ভাবন করা হয়েছিল।[1] যদিও এটি সেই লক্ষ্যে সফল হয়েছিল এবং মানুষের ওপর নিদ্রাকারক ও ব্যথানাশক উভয় হিসেবেই দ্বিতীয় পর্যায়ের ক্লিনিক্যাল ট্রায়াল পর্যন্ত অগ্রসর হয়েছিল, তবে প্রাথমিক পরীক্ষায় তুলনামূলক ওষুধগুলোর (যথাক্রমে midazolam এবং morphine) তুলনায় এর ফলাফল খুব একটা আশাব্যঞ্জক ছিল না।[2][3]
আরও দেখুন
তথ্যসূত্র
- ↑ Adam, J. M.. (2010). "Design, synthesis, and structure–activity relationships of indole-3-carboxamides as novel water soluble cannabinoid CB1 receptor agonists". MedChemComm. 1 54. doi:10.1039/c0md00022a.
- ↑ (August 2009). "Pharmacodynamic and pharmacokinetic effects of the intravenously administered CB1 receptor agonist Org 28611 in healthy male volunteers". Journal of Psychopharmacology. 23 (6) 633–44. doi:10.1177/0269881108091551.
- ↑ A Comparison of Analgesic Efficacy Between a Single Dose of ORG 28611, Morphine, and Placebo After Dental Impaction Surgery
উৎস: ইংরেজি উইকিপিডিয়ার “Org 28611” নিবন্ধের অনুবাদ। মূল নিবন্ধ: https://en.wikipedia.org/wiki/Org_28611 এই অনুবাদটি স্বয়ংক্রিয়ভাবে প্রস্তুত করা হয়েছে।
