JWH-198
| তথ্যছক | |
|---|---|
| verifiedfields | changed |
| verifiedrevid | 451606850 |
| iupac_name | (1-(2-Morpholin-4-ylethyl)indol-3-yl)-4-methoxynaphthalen-1-ylmethanone |
| width | 150 |
| pregnancy_au | |
| pregnancy_us | |
| legal_au | |
| legal_ca | Schedule II |
| legal_de | NpSG |
| legal_uk | Class B |
| legal_us | Schedule I |
| routes_of_administration | |
| excretion | |
| cas_number_ref | ?? |
| cas_number | 166599-76-4 |
| unii_ref | FDA |
| unii | J53IGM38PB |
| pubchem | 10319620 |
| drugbank_ref | drugbank |
| chemspiderid_ref | chemspider |
| chemspiderid | 8495084 |
| c | 26 |
| h | 26 |
| n | 2 |
| o | 3 |
| smiles | C4COCCN4CCn2cc(c5ccccc25)C(=O)c3c1ccccc1c(OC)cc3 |
| stdinchi_ref | chemspider |
| stdinchi | 1S/C26H26N2O3/c1-30-25-11-10-22(19-6-2-3-8-21(19)25)26(29)23-18-28(24-9-5-4-7-20(23)24)13-12-27-14-16-31-17-15-27/h2-11,18H,12-17H2,1H3 |
| stdinchikey_ref | chemspider |
| stdinchikey | QWHSUXWDDKWTOG-UHFFFAOYSA-N |
JWH-198 হলো aminoalkylindole এবং naphthoylindole পরিবারের একটি ওষুধ, যা cannabinoid receptor agonist হিসেবে কাজ করে। এটি ১৯৯০-এর দশকের শুরুর দিকে সানোফি-উইনথ্রপ (Sanofi-Winthrop) নামক ওষুধ প্রস্তুতকারী কোম্পানি উদ্ভাবন করে। JWH-198-এর CB1 রিসেপ্টরে বাইন্ডিং অ্যাফিনিটি (binding affinity) হলো ১০ nM, যা এর মূল যৌগ JWH-200-এর তুলনায় প্রায় চার গুণ বেশি শক্তিশালী; উল্লেখ্য যে, JWH-200-এর ন্যাপথোয়েল বলয়ে কোনো প্রতিস্থাপন থাকে না।[1] এটি মূলত ক্যানাবিনয়েড রিসেপ্টরগুলোর molecular modelling-এর ক্ষেত্রে ব্যবহৃত হয়ে আসছে।[2][3]
যুক্তরাষ্ট্রে, ৩-(১-ন্যাপথোয়েল)ইন্ডোল শ্রেণির সকল CB1 রিসেপ্টর অ্যাগোনিস্ট, যেমন JWH-198, শিডিউল ১ নিয়ন্ত্রিত পদার্থ (Schedule I Controlled Substances) হিসেবে গণ্য হয়।[4]
আরও দেখুন
তথ্যসূত্র
- ↑ (2005). "Recent developments in the medicinal chemistry of cannabimimetic indoles, pyrroles and indenes". Current Medicinal Chemistry. 12 (12) 1395–411. doi:10.2174/0929867054020864.
- ↑ (Aug 1995). "Aminoalkylindoles: structure-activity relationships of novel cannabinoid mimetics". Journal of Medicinal Chemistry. 38 (16) 3094–105. doi:10.1021/jm00016a013.
- ↑ (Nov 1998). "Three-dimensional quantitative structure-activity relationship study of the cannabimimetic (aminoalkyl)indoles using comparative molecular field analysis". Journal of Medicinal Chemistry. 41 (23) 4521–32. doi:10.1021/jm980305c.
- ↑ Schedules of controlled substances
উৎস: ইংরেজি উইকিপিডিয়ার “JWH-198” নিবন্ধের অনুবাদ। মূল নিবন্ধ: https://en.wikipedia.org/wiki/JWH-198 এই অনুবাদটি স্বয়ংক্রিয়ভাবে প্রস্তুত করা হয়েছে।
