BML-190
From LTRC
| তথ্যছক | |
|---|---|
| verifiedfields | changed |
| watchedfields | changed |
| verifiedrevid | 444674170 |
| width | 250px |
| pregnancy_au | |
| pregnancy_us | |
| atc_prefix | None |
| atc_suffix | |
| legal_au | |
| legal_ca | |
| legal_uk | |
| legal_us | |
| legal_status | |
| excretion | |
| cas_number_ref | ?? |
| cas_number | 2854-32-2 |
| pubchem | 2415 |
| chemspiderid_ref | chemspider |
| chemspiderid | 2321 |
| drugbank_ref | drugbank |
| synonyms | BML190; Indomethacin morpholinylamide |
| iupac_name | 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-1-morpholin-4-ylethanone |
| c | 23 |
| h | 23 |
| cl | 1 |
| n | 2 |
| o | 4 |
| smiles | C4COCCN4C(=O)Cc(c(c1cc2)cc2OC)c(C)n1C(=O)c3ccc(Cl)cc3 |
| stdinchi_ref | chemspider |
| stdinchi | 1S/C23H23ClN2O4/c1-15-19(14-22(27)25-9-11-30-12-10-25)20-13-18(29-2)7-8-21(20)26(15)23(28)16-3-5-17(24)6-4-16/h3-8,13H,9-12,14H2,1-2H3 |
| stdinchikey_ref | chemspider |
| stdinchikey | BJSDNVVWJYDOLK-UHFFFAOYSA-N |
BML-190, যা ইন্ডোমেথাসিন মরফোলিনাইলঅ্যামাইড (indomethacin morpholinylamide) নামেও পরিচিত, বৈজ্ঞানিক গবেষণায় ব্যবহৃত একটি ওষুধ যা একটি সিলেক্টিভ CB2 inverse agonist হিসেবে কাজ করে।[1] BML-190 গাঠনিকভাবে NSAID indomethacin থেকে উদ্ভূত হলেও এর জৈবিক কার্যকারিতা বেশ ভিন্ন।[2] এই যৌগের কার্যকারিতা নিয়ে বিতর্ক রয়েছে; কিছু উৎস একে CB2 agonist হিসেবে উল্লেখ করে, inverse agonist হিসেবে নয়।[3][4] এটি সম্ভবত শ্রেণিবিন্যাসের কোনো ত্রুটির কারণে হতে পারে, অথবা এটি বিভিন্ন টিস্যুতে ভিন্ন ভিন্ন প্রভাব ফেলতে পারে। এই বিতর্ক নিরসনের জন্য আরও গবেষণার প্রয়োজন।
আরও দেখুন
তথ্যসূত্র
- ↑ (February 2003). "BML-190 and AM251 act as inverse agonists at the human cannabinoid CB2 receptor: signalling via cAMP and inositol phosphates". FEBS Letters. 536 (1–3) 157–60. doi:10.1016/S0014-5793(03)00048-6.
- ↑ (June 2003). "Reduction of human monocytic cell neurotoxicity and cytokine secretion by ligands of the cannabinoid-type CB2 receptor". British Journal of Pharmacology. 139 (4) 775–86. doi:10.1038/sj.bjp.0705304.
- ↑ (January 2000). "Suppression of nerve growth factor Trk receptors and prolactin receptors by endocannabinoids leads to inhibition of human breast and prostate cancer cell proliferation". Endocrinology. 141 (1) 118–26. doi:10.1210/endo.141.1.7239.
- ↑ (January 2007). "Cannabinoids stimulate fibroblastic colony formation by bone marrow cells indirectly via CB2 receptors". Calcified Tissue International. 80 (1) 50–9. doi:10.1007/s00223-006-0171-7.
উৎস: ইংরেজি উইকিপিডিয়ার “BML-190” নিবন্ধের অনুবাদ। মূল নিবন্ধ: https://en.wikipedia.org/wiki/BML-190 এই অনুবাদটি স্বয়ংক্রিয়ভাবে প্রস্তুত করা হয়েছে।
