GW-405,833
| তথ্যছক | |
|---|---|
| verifiedfields | changed |
| watchedfields | changed |
| verifiedrevid | 424782539 |
| iupac_name | 1-(2,3-Dichlorobenzoyl)-5-methoxy-2-methyl-3-[2-(4-morpholinyl)ethyl]-1H-indole |
| width | 240px |
| routes_of_administration | |
| excretion | |
| cas_number_ref | ?? |
| cas_number | 180002-83-9 |
| unii_ref | FDA |
| unii | 85K154W99L |
| pubchem | 9911463 |
| chebi | 92184 |
| chembl_ref | EBI |
| chembl | 73711 |
| chemspiderid | 8087114 |
| chemspiderid_ref | chemspider |
| smiles | CC1=C(C2=C(N1C(=O)C3=C(C(=CC=C3)Cl)Cl)C=CC(=C2)OC)CCN4CCOCC4 |
| smiles2 | C4COCCN4CCc1c(C)n(c(ccc3OC)c1c3)C(=O)c2cccc(Cl)c2Cl |
| stdinchi_ref | chemspider |
| stdinchi | 1S/C23H24Cl2N2O3/c1-15-17(8-9-26-10-12-30-13-11-26)19-14-16(29-2)6-7-21(19)27(15)23(28)18-4-3-5-20(24)22(18)25/h3-7,14H,8-13H2,1-2H3 |
| stdinchikey_ref | chemspider |
| stdinchikey | FSFZRNZSZYDVLI-UHFFFAOYSA-N |
| c | 23 |
| h | 24 |
| cl | 2 |
| n | 2 |
| o | 3 |
GW-405,833 (L-768,242) হলো এমন একটি ওষুধ যা ক্যানাবিনয়েড রিসেপ্টর উপধরন CB2-এর একটি শক্তিশালী এবং নির্বাচনী partial agonist হিসেবে কাজ করে। এর EC50 মান ০.৬৫ nM এবং এটি CB1 রিসেপ্টরের তুলনায় CB2 রিসেপ্টরের প্রতি প্রায় ১২০০ গুণ বেশি নির্বাচনী।[1][2] প্রাণীদের ওপর করা গবেষণায় দেখা গেছে যে, কম মাত্রায় এটি প্রদাহরোধী এবং হাইপারালজেসিয়া-বিরোধী (anti-hyperalgesic) প্রভাব ফেলে। তবে মাত্রা বাড়ালে এর ফলে অ্যাটাক্সিয়া এবং ব্যথানাশক প্রভাব পরিলক্ষিত হয়।[3][4] GW-405,833-এর মতো নির্বাচনী CB2 অ্যাগোনিস্ট ওষুধগুলো অ্যালোডিনিয়া এবং নিউরোপ্যাথিক ব্যথার চিকিৎসায় অত্যন্ত কার্যকর হতে পারে বলে আশা করা হচ্ছে, কারণ এই ধরনের ব্যথার বর্তমান চিকিৎসা পদ্ধতিগুলো প্রায়শই অপর্যাপ্ত।[5][6]
তথ্যসূত্র
- ↑ (September 2000). "The search for selective ligands for the CB2 receptor". Current Pharmaceutical Design. 6 (13) 1323–37. doi:10.2174/1381612003399347.
- ↑ (2008). "Recent advances in the development of selective ligands for the cannabinoid CB(2) receptor". Current Topics in Medicinal Chemistry. 8 (3) 187–204. doi:10.2174/156802608783498014.
- ↑ (April 2002). "CB1 and CB2 cannabinoid receptors are implicated in inflammatory pain". Pain. 96 (3) 253–60. doi:10.1016/s0304-3959(01)00454-7.
- ↑ (April 2005). "Pharmacological and pharmacokinetic characterization of the cannabinoid receptor 2 agonist, GW405833, utilizing rodent models of acute and chronic pain, anxiety, ataxia and catalepsy". Neuropharmacology. 48 (5) 658–72. doi:10.1016/j.neuropharm.2004.12.008.
- ↑ (March 2006). "CB2 receptor-mediated antihyperalgesia: possible direct involvement of neural mechanisms". The European Journal of Neuroscience. 23 (6) 1530–8. doi:10.1111/j.1460-9568.2006.04684.x.
- ↑ (June 2009). "Analgesic and antiinflammatory effects of cannabinoid receptor agonists in a rat model of neuropathic pain". Naunyn-Schmiedeberg's Archives of Pharmacology. 379 (6) 627–36. doi:10.1007/s00210-008-0386-4.
উৎস: ইংরেজি উইকিপিডিয়ার “GW-405,833” নিবন্ধের অনুবাদ। মূল নিবন্ধ: https://en.wikipedia.org/wiki/GW-405,833 এই অনুবাদটি স্বয়ংক্রিয়ভাবে প্রস্তুত করা হয়েছে।
