BAY 38-7271
| তথ্যছক | |
|---|---|
| verifiedfields | changed |
| watchedfields | changed |
| verifiedrevid | 461342730 |
| iupac_name | (−)-(R)-3-(2-Hydroxymethylindanyl-4-oxy)phenyl-4,4,4-trifluorobutyl-1-sulfonate |
| width | 220 |
| legal_ca | Schedule II |
| routes_of_administration | |
| excretion | |
| pubchem | 9845561 |
| chemspiderid_ref | chemspider |
| chemspiderid | 8021275 |
| chembl_ref | EBI |
| chembl | 1668508 |
| smiles | FC(F)(F)CCCS(=O)(=O)Oc3cccc(Oc1cccc2c1C[C@@H](C2)CO)c3 |
| stdinchi_ref | chemspider |
| stdinchi | 1S/C20H21F3O5S/c21-20(22,23)8-3-9-29(25,26)28-17-6-2-5-16(12-17)27-19-7-1-4-15-10-14(13-24)11-18(15)19/h1-2,4-7,12,14,24H,3,8-11,13H2/t14-/m1/s1 |
| stdinchikey_ref | chemspider |
| stdinchikey | XJURALZPEJKKOV-CQSZACIVSA-N |
| cas_number_ref | ?? |
| cas_number | 212188-60-8 |
| unii_ref | FDA |
| unii | SRX4T6TMUS |
| c | 20 |
| h | 21 |
| f | 3 |
| o | 5 |
| s | 1 |
রসায়নবিদ ওয়েন ই. কেনি কর্তৃক প্রথম সংশ্লেষিত BAY 38-7271 (যা KN 38-7271 নামেও পরিচিত) হলো একটি ওষুধ, যা বেয়ার এজি (Bayer AG) কর্তৃক উদ্ভাবিত একটি cannabinoid receptor অ্যাগোনিস্ট। এর analgesic (ব্যথানাশক) এবং neuroprotective (স্নায়ু সুরক্ষাকারী) গুণাগুণ রয়েছে এবং এটি বৈজ্ঞানিক গবেষণায় ব্যবহৃত হয়। ট্রমাটিক ব্রেইন ইনজুরি বা মস্তিষ্কের আঘাতজনিত সমস্যার চিকিৎসায় এর ব্যবহারের প্রস্তাব করা হয়েছে।[1][2] এটি একটি full agonist, যা প্রাণীদের ওপর চালানো গবেষণায় CP 55,940-এর প্রায় সমতুল্য কার্যকারিতা প্রদর্শন করে। এটি CB1 এবং CB2 উভয় রিসেপ্টরের সাথেই বেশ উচ্চ মাত্রায় আবদ্ধ হতে পারে, যেখানে CB1-এর ক্ষেত্রে এর Ki মান ২.৯১ nM এবং CB2-এর ক্ষেত্রে ৪.২৪ nM।[3][4] ক্লিনিকাল উন্নয়নের জন্য এর লাইসেন্স KeyNeurotek Pharmaceuticals-কে প্রদান করা হয়েছিল[5] এবং ২০০৮ সালে এটি Phase II trials-এর পর্যায়ে ছিল,[6] তবে এর উন্নয়ন কার্যক্রম সম্ভবত বন্ধ হয়ে গেছে।
তথ্যসূত্র
- ↑ (2003). "BAY 38-7271: a novel highly selective and highly potent cannabinoid receptor agonist for the treatment of traumatic brain injury". CNS Drug Reviews. 9 (4) 343–58. doi:10.1111/j.1527-3458.2003.tb00259.x.
- ↑ (October 2003). "Neuroprotective and brain edema-reducing efficacy of the novel cannabinoid receptor agonist BAY 38-7271". Brain Research. 989 (1) 99–111. doi:10.1016/s0006-8993(03)03376-6.
- ↑ (July 2002). "Characterization of the diarylether sulfonylester (-)-(R)-3-(2-hydroxymethylindanyl-4-oxy)phenyl-4,4,4-trifluoro-1-sulfonate (BAY 38-7271) as a potent cannabinoid receptor agonist with neuroprotective properties". The Journal of Pharmacology and Experimental Therapeutics. 302 (1) 359–68. doi:10.1124/jpet.302.1.359.
- ↑ (December 2002). "Discriminative stimulus effects of BAY 38-7271, a novel cannabinoid receptor agonist". European Journal of Pharmacology. 457 (2–3) 147–52. doi:10.1016/s0014-2999(02)02697-3.
- ↑ Pipeline
- ↑ KeyNeurotek Pharmaceuticals AG Reports Positive Phase I Data of Its Cannabinoid Receptor-Agonist
উৎস: ইংরেজি উইকিপিডিয়ার “BAY 38-7271” নিবন্ধের অনুবাদ। মূল নিবন্ধ: https://en.wikipedia.org/wiki/BAY_38-7271 এই অনুবাদটি স্বয়ংক্রিয়ভাবে প্রস্তুত করা হয়েছে।
