অ্যালেনস্ট্রল
From LTRC
| তথ্যছক | |
|---|---|
| iupac_name | 3-(6-Hydroxynaphthalen-2-yl)-2,2-dimethylpentanoic acid |
| width | 250 |
| pregnancy_au | |
| pregnancy_us | |
| legal_au | |
| routes_of_administration | |
| excretion | |
| cas_number | 15372-37-9 |
| unii_ref | FDA |
| unii | 6J0J47Q1NX |
| pubchem | 254232 |
| chemspiderid | 222838 |
| kegg | C14719 |
| chebi | 34865 |
| chembl | 1978410 |
| c | 17 |
| h | 20 |
| o | 3 |
| smiles | CCC(C1=CC2=C(C=C1)C=C(C=C2)O)C(C)(C)C(=O)O |
| stdinchi | 1S/C17H20O3/c1-4-15(17(2,3)16(19)20)13-6-5-12-10-14(18)8-7-11(12)9-13/h5-10,15,18H,4H2,1-3H3,(H,19,20) |
| stdinchikey | OKLBSPJQRWHBMY-UHFFFAOYSA-N |
| synonyms | Allenestril; Allenoestril; α,α-Dimethyl-β-ethylallenolic acid; Dimethylethylallenolic acid; Methallenestrilphenol; Methallenestrolphenol |
অ্যালেনস্ট্রল (Allenestrol), যা অ্যালেনোস্ট্রল (allenoestrol) নামেও পরিচিত, এছাড়া একে α,α-ডাইমিথাইল-β-ইথাইলঅ্যালেনোলিক অ্যাসিড (α,α-dimethyl-β-ethylallenolic acid) বা মিথ্যালেনস্ট্রিলফেনল (methallenestrilphenol)-ও বলা হয়। এটি একটি সংশ্লেষিত (synthetic), নন-স্টেরয়েডাল ইস্ট্রোজেন এবং অ্যালেনোলিক অ্যাসিডের একটি রাসায়নিক ডেরিভেটিভ বা উপজাত, যা কখনোই বাজারজাত করা হয়নি।[1][2][3] অ্যালেনস্ট্রলের একটি মিথাইল ইথার হলো মিথ্যালেনস্ট্রিল (methallenestrol), যা নিজেও একটি ইস্ট্রোজেন। তবে অ্যালেনস্ট্রলের বিপরীতে, মিথ্যালেনস্ট্রিল বাজারজাত করা হয়েছিল।[4]
আরও দেখুন
তথ্যসূত্র
- ↑ (4 October 2001). Organic-chemical drugs and their synonyms: (an international survey). Wiley-VCH. ISBN 978-3-527-30247-5.
- ↑ (11 June 2003). The Practice of Medicinal Chemistry. 216–. Academic Press. ISBN 978-0-08-049777-8.
- ↑ (1 July 2015). The Practice of Medicinal Chemistry. 245–. Elsevier Science. ISBN 978-0-12-417213-5.
- ↑ (14 November 2014). The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies. 781–. Springer. ISBN 978-1-4757-2085-3.
উৎস: ইংরেজি উইকিপিডিয়ার “Allenestrol” নিবন্ধের অনুবাদ। মূল নিবন্ধ: https://en.wikipedia.org/wiki/Allenestrol এই অনুবাদটি স্বয়ংক্রিয়ভাবে প্রস্তুত করা হয়েছে।
